C18H21ClN4O3 — CID 119847226
4-amino-5-chloro-2-methoxy-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]benzamide (PubChem CID 119847226) has the molecular formula C18H21ClN4O3 and a molecular weight of 376.84 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]benzamide |
|---|---|
| PubChem CID | 119847226 |
| Molecular Formula | C18H21ClN4O3 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]benzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCc1cccnc1N1CCOCC1 |
| InChI | InChI=1S/C18H21ClN4O3/c1-25-16-10-15(20)14(19)9-13(16)18(24)22-11-12-3-2-4-21-17(12)23-5-7-26-8-6-23/h2-4,9-10H,5-8,11,20H2,1H3,(H,22,24) |
| InChIKey | MVLZVVJSUDWVFJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|