C23H30ClN3O4 — CID 38540995
3-chloro-5-methoxy-4-(3-methylbutoxy)-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]benzamide (PubChem CID 38540995) has the molecular formula C23H30ClN3O4 and a molecular weight of 447.96 g/mol. Its IUPAC name is 3-chloro-5-methoxy-4-(3-methylbutoxy)-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]benzamide.
| Compound Name | 3-chloro-5-methoxy-4-(3-methylbutoxy)-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]benzamide |
|---|---|
| PubChem CID | 38540995 |
| Molecular Formula | C23H30ClN3O4 |
| Molecular Weight | 447.96 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 3-chloro-5-methoxy-4-(3-methylbutoxy)-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]benzamide |
| SMILES | COc1cc(C(=O)NCc2cccnc2N2CCOCC2)cc(Cl)c1OCCC(C)C |
| InChI | InChI=1S/C23H30ClN3O4/c1-16(2)6-10-31-21-19(24)13-18(14-20(21)29-3)23(28)26-15-17-5-4-7-25-22(17)27-8-11-30-12-9-27/h4-5,7,13-14,16H,6,8-12,15H2,1-3H3,(H,26,28) |
| InChIKey | QUWMOEIQDKQRLX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.96 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |