C18H22ClNO3S — CID 31288260
3-chloro-5-methoxy-4-(3-methylbutoxy)-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 31288260) has the molecular formula C18H22ClNO3S and a molecular weight of 367.90 g/mol. Its IUPAC name is 3-chloro-5-methoxy-4-(3-methylbutoxy)-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 3-chloro-5-methoxy-4-(3-methylbutoxy)-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 31288260 |
| Molecular Formula | C18H22ClNO3S |
| Molecular Weight | 367.90 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 3-chloro-5-methoxy-4-(3-methylbutoxy)-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | COc1cc(C(=O)NCc2cccs2)cc(Cl)c1OCCC(C)C |
| InChI | InChI=1S/C18H22ClNO3S/c1-12(2)6-7-23-17-15(19)9-13(10-16(17)22-3)18(21)20-11-14-5-4-8-24-14/h4-5,8-10,12H,6-7,11H2,1-3H3,(H,20,21) |
| InChIKey | IMWFVELGHJRYFQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.90 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |