C21H26ClN3O4 — CID 55521138
3-chloro-5-methoxy-4-(3-methylbutoxy)-N-[4-(methylcarbamoylamino)phenyl]benzamide (PubChem CID 55521138) has the molecular formula C21H26ClN3O4 and a molecular weight of 419.91 g/mol. Its IUPAC name is 3-chloro-5-methoxy-4-(3-methylbutoxy)-N-[4-(methylcarbamoylamino)phenyl]benzamide.
| Compound Name | 3-chloro-5-methoxy-4-(3-methylbutoxy)-N-[4-(methylcarbamoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 55521138 |
| Molecular Formula | C21H26ClN3O4 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 3-chloro-5-methoxy-4-(3-methylbutoxy)-N-[4-(methylcarbamoylamino)phenyl]benzamide |
| SMILES | CNC(=O)Nc1ccc(NC(=O)c2cc(Cl)c(OCCC(C)C)c(OC)c2)cc1 |
| InChI | InChI=1S/C21H26ClN3O4/c1-13(2)9-10-29-19-17(22)11-14(12-18(19)28-4)20(26)24-15-5-7-16(8-6-15)25-21(27)23-3/h5-8,11-13H,9-10H2,1-4H3,(H,24,26)(H2,23,25,27) |
| InChIKey | ITBKURFVVGTHDQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |