C23H26ClNO6 — CID 42487122
[2-(4-acetamidophenyl)-2-oxoethyl] 3-chloro-5-methoxy-4-(3-methylbutoxy)benzoate (PubChem CID 42487122) has the molecular formula C23H26ClNO6 and a molecular weight of 447.92 g/mol. Its IUPAC name is [2-(4-acetamidophenyl)-2-oxoethyl] 3-chloro-5-methoxy-4-(3-methylbutoxy)benzoate.
| Compound Name | [2-(4-acetamidophenyl)-2-oxoethyl] 3-chloro-5-methoxy-4-(3-methylbutoxy)benzoate |
|---|---|
| PubChem CID | 42487122 |
| Molecular Formula | C23H26ClNO6 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | [2-(4-acetamidophenyl)-2-oxoethyl] 3-chloro-5-methoxy-4-(3-methylbutoxy)benzoate |
| SMILES | COc1cc(C(=O)OCC(=O)c2ccc(NC(C)=O)cc2)cc(Cl)c1OCCC(C)C |
| InChI | InChI=1S/C23H26ClNO6/c1-14(2)9-10-30-22-19(24)11-17(12-21(22)29-4)23(28)31-13-20(27)16-5-7-18(8-6-16)25-15(3)26/h5-8,11-12,14H,9-10,13H2,1-4H3,(H,25,26) |
| InChIKey | PRTUOZXMJQBGFZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |