C21H25ClFNO3 — CID 18268789
3-chloro-N-[2-(4-fluorophenyl)ethyl]-5-methoxy-4-(3-methylbutoxy)benzamide (PubChem CID 18268789) has the molecular formula C21H25ClFNO3 and a molecular weight of 393.89 g/mol. Its IUPAC name is 3-chloro-N-[2-(4-fluorophenyl)ethyl]-5-methoxy-4-(3-methylbutoxy)benzamide.
| Compound Name | 3-chloro-N-[2-(4-fluorophenyl)ethyl]-5-methoxy-4-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 18268789 |
| Molecular Formula | C21H25ClFNO3 |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 3-chloro-N-[2-(4-fluorophenyl)ethyl]-5-methoxy-4-(3-methylbutoxy)benzamide |
| SMILES | COc1cc(C(=O)NCCc2ccc(F)cc2)cc(Cl)c1OCCC(C)C |
| InChI | InChI=1S/C21H25ClFNO3/c1-14(2)9-11-27-20-18(22)12-16(13-19(20)26-3)21(25)24-10-8-15-4-6-17(23)7-5-15/h4-7,12-14H,8-11H2,1-3H3,(H,24,25) |
| InChIKey | NIFGSQGHFNEKHC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |