C19H27ClN4O3S — CID 56562290
3-chloro-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-5-methoxy-4-(3-methylbutoxy)benzamide (PubChem CID 56562290) has the molecular formula C19H27ClN4O3S and a molecular weight of 426.97 g/mol. Its IUPAC name is 3-chloro-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-5-methoxy-4-(3-methylbutoxy)benzamide.
| Compound Name | 3-chloro-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-5-methoxy-4-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 56562290 |
| Molecular Formula | C19H27ClN4O3S |
| Molecular Weight | 426.97 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 3-chloro-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-5-methoxy-4-(3-methylbutoxy)benzamide |
| SMILES | CCn1c(CCNC(=O)c2cc(Cl)c(OCCC(C)C)c(OC)c2)n[nH]c1=S |
| InChI | InChI=1S/C19H27ClN4O3S/c1-5-24-16(22-23-19(24)28)6-8-21-18(25)13-10-14(20)17(15(11-13)26-4)27-9-7-12(2)3/h10-12H,5-9H2,1-4H3,(H,21,25)(H,23,28) |
| InChIKey | HKNCEZYKOCAMJJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.97 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|