C20H26Cl3N3O3 — CID 119834795
4-amino-5-chloro-2-methoxy-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]benzamide;dihydrochloride (PubChem CID 119834795) has the molecular formula C20H26Cl3N3O3 and a molecular weight of 462.81 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]benzamide;dihydrochloride.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119834795 |
| Molecular Formula | C20H26Cl3N3O3 |
| Molecular Weight | 462.81 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]benzamide;dihydrochloride |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCc1ccccc1CN1CCOCC1.Cl.Cl |
| InChI | InChI=1S/C20H24ClN3O3.2ClH/c1-26-19-11-18(22)17(21)10-16(19)20(25)23-12-14-4-2-3-5-15(14)13-24-6-8-27-9-7-24;;/h2-5,10-11H,6-9,12-13,22H2,1H3,(H,23,25);2*1H |
| InChIKey | AGXOFHFBKQKNCO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.81 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|