C16H19ClN2O2S — CID 119787675
4-amino-5-chloro-2-methoxy-N-(2-methyl-2-thiophen-2-ylpropyl)benzamide (PubChem CID 119787675) has the molecular formula C16H19ClN2O2S and a molecular weight of 338.86 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-(2-methyl-2-thiophen-2-ylpropyl)benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-(2-methyl-2-thiophen-2-ylpropyl)benzamide |
|---|---|
| PubChem CID | 119787675 |
| Molecular Formula | C16H19ClN2O2S |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-(2-methyl-2-thiophen-2-ylpropyl)benzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC(C)(C)c1cccs1 |
| InChI | InChI=1S/C16H19ClN2O2S/c1-16(2,14-5-4-6-22-14)9-19-15(20)10-7-11(17)12(18)8-13(10)21-3/h4-8H,9,18H2,1-3H3,(H,19,20) |
| InChIKey | OBXOHMCOVLWLRI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|