C15H22Cl2N2O3S — CID 119805573
4-amino-5-chloro-2-methoxy-N-[(4-methylsulfanyloxan-4-yl)methyl]benzamide;hydrochloride (PubChem CID 119805573) has the molecular formula C15H22Cl2N2O3S and a molecular weight of 381.33 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[(4-methylsulfanyloxan-4-yl)methyl]benzamide;hydrochloride.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[(4-methylsulfanyloxan-4-yl)methyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119805573 |
| Molecular Formula | C15H22Cl2N2O3S |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[(4-methylsulfanyloxan-4-yl)methyl]benzamide;hydrochloride |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC1(SC)CCOCC1.Cl |
| InChI | InChI=1S/C15H21ClN2O3S.ClH/c1-20-13-8-12(17)11(16)7-10(13)14(19)18-9-15(22-2)3-5-21-6-4-15;/h7-8H,3-6,9,17H2,1-2H3,(H,18,19);1H |
| InChIKey | JHDRVQYPVMTQLB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|