C14H23Cl2N3O3 — CID 175674084
2-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-N,N-diethylethanamine oxide;hydrochloride (PubChem CID 175674084) has the molecular formula C14H23Cl2N3O3 and a molecular weight of 352.26 g/mol. Its IUPAC name is 2-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-N,N-diethylethanamine oxide;hydrochloride.
| Compound Name | 2-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-N,N-diethylethanamine oxide;hydrochloride |
|---|---|
| PubChem CID | 175674084 |
| Molecular Formula | C14H23Cl2N3O3 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 2-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-N,N-diethylethanamine oxide;hydrochloride |
| SMILES | CC[N+]([O-])(CC)CCNC(=O)c1cc(Cl)c(N)cc1OC.Cl |
| InChI | InChI=1S/C14H22ClN3O3.ClH/c1-4-18(20,5-2)7-6-17-14(19)10-8-11(15)12(16)9-13(10)21-3;/h8-9H,4-7,16H2,1-3H3,(H,17,19);1H |
| InChIKey | ZESDUVLKRHTCIM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 87.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|