C14H20Cl2N2O4 — CID 119789268
ethyl 3-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-2-methylpropanoate;hydrochloride (PubChem CID 119789268) has the molecular formula C14H20Cl2N2O4 and a molecular weight of 351.23 g/mol. Its IUPAC name is ethyl 3-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-2-methylpropanoate;hydrochloride.
| Compound Name | ethyl 3-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-2-methylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 119789268 |
| Molecular Formula | C14H20Cl2N2O4 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | ethyl 3-[(4-amino-5-chloro-2-methoxybenzoyl)amino]-2-methylpropanoate;hydrochloride |
| SMILES | CCOC(=O)C(C)CNC(=O)c1cc(Cl)c(N)cc1OC.Cl |
| InChI | InChI=1S/C14H19ClN2O4.ClH/c1-4-21-14(19)8(2)7-17-13(18)9-5-10(15)11(16)6-12(9)20-3;/h5-6,8H,4,7,16H2,1-3H3,(H,17,18);1H |
| InChIKey | DRHIKWLTEXBRAR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|