C20H24Cl2N2O4 — CID 119778002
methyl 2-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]-3-(3-methylphenyl)propanoate;hydrochloride (PubChem CID 119778002) has the molecular formula C20H24Cl2N2O4 and a molecular weight of 427.33 g/mol. Its IUPAC name is methyl 2-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]-3-(3-methylphenyl)propanoate;hydrochloride.
| Compound Name | methyl 2-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]-3-(3-methylphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 119778002 |
| Molecular Formula | C20H24Cl2N2O4 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | methyl 2-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]-3-(3-methylphenyl)propanoate;hydrochloride |
| SMILES | COC(=O)C(CNC(=O)c1cc(Cl)c(N)cc1OC)Cc1cccc(C)c1.Cl |
| InChI | InChI=1S/C20H23ClN2O4.ClH/c1-12-5-4-6-13(7-12)8-14(20(25)27-3)11-23-19(24)15-9-16(21)17(22)10-18(15)26-2;/h4-7,9-10,14H,8,11,22H2,1-3H3,(H,23,24);1H |
| InChIKey | LIEGYCXLSDIKQF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|