C20H28Cl3N3O2 — CID 119847474
4-amino-5-chloro-N-[[3-(diethylaminomethyl)phenyl]methyl]-2-methoxybenzamide;dihydrochloride (PubChem CID 119847474) has the molecular formula C20H28Cl3N3O2 and a molecular weight of 448.82 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[[3-(diethylaminomethyl)phenyl]methyl]-2-methoxybenzamide;dihydrochloride.
| Compound Name | 4-amino-5-chloro-N-[[3-(diethylaminomethyl)phenyl]methyl]-2-methoxybenzamide;dihydrochloride |
|---|---|
| PubChem CID | 119847474 |
| Molecular Formula | C20H28Cl3N3O2 |
| Molecular Weight | 448.82 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 4-amino-5-chloro-N-[[3-(diethylaminomethyl)phenyl]methyl]-2-methoxybenzamide;dihydrochloride |
| SMILES | CCN(CC)Cc1cccc(CNC(=O)c2cc(Cl)c(N)cc2OC)c1.Cl.Cl |
| InChI | InChI=1S/C20H26ClN3O2.2ClH/c1-4-24(5-2)13-15-8-6-7-14(9-15)12-23-20(25)16-10-17(21)18(22)11-19(16)26-3;;/h6-11H,4-5,12-13,22H2,1-3H3,(H,23,25);2*1H |
| InChIKey | BILZIGAGNATHNR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.82 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|