C18H22Cl2N2O5 — CID 119719615
4-amino-5-chloro-N-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-2-methoxybenzamide;hydrochloride (PubChem CID 119719615) has the molecular formula C18H22Cl2N2O5 and a molecular weight of 417.29 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-2-methoxybenzamide;hydrochloride.
| Compound Name | 4-amino-5-chloro-N-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-2-methoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 119719615 |
| Molecular Formula | C18H22Cl2N2O5 |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 4-amino-5-chloro-N-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-2-methoxybenzamide;hydrochloride |
| SMILES | COc1ccc(OC)c(C(O)CNC(=O)c2cc(Cl)c(N)cc2OC)c1.Cl |
| InChI | InChI=1S/C18H21ClN2O5.ClH/c1-24-10-4-5-16(25-2)11(6-10)15(22)9-21-18(23)12-7-13(19)14(20)8-17(12)26-3;/h4-8,15,22H,9,20H2,1-3H3,(H,21,23);1H |
| InChIKey | FEPCDEMTVHGUKN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|