C17H28ClN3O2 — CID 10617240
4-amino-5-chloro-N-[3-(dimethylamino)-3-ethylpentyl]-2-methoxybenzamide (PubChem CID 10617240) has the molecular formula C17H28ClN3O2 and a molecular weight of 341.88 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[3-(dimethylamino)-3-ethylpentyl]-2-methoxybenzamide.
| Compound Name | 4-amino-5-chloro-N-[3-(dimethylamino)-3-ethylpentyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 10617240 |
| Molecular Formula | C17H28ClN3O2 |
| Molecular Weight | 341.88 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 4-amino-5-chloro-N-[3-(dimethylamino)-3-ethylpentyl]-2-methoxybenzamide |
| SMILES | CCC(CC)(CCNC(=O)c1cc(Cl)c(N)cc1OC)N(C)C |
| InChI | InChI=1S/C17H28ClN3O2/c1-6-17(7-2,21(3)4)8-9-20-16(22)12-10-13(18)14(19)11-15(12)23-5/h10-11H,6-9,19H2,1-5H3,(H,20,22) |
| InChIKey | RFLDYWOAJAVGDP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.88 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|