C15H24ClN3O3 — CID 119892903
4-amino-5-chloro-2-methoxy-N-[2-[3-methoxypropyl(methyl)amino]ethyl]benzamide (PubChem CID 119892903) has the molecular formula C15H24ClN3O3 and a molecular weight of 329.83 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[2-[3-methoxypropyl(methyl)amino]ethyl]benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[2-[3-methoxypropyl(methyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 119892903 |
| Molecular Formula | C15H24ClN3O3 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[2-[3-methoxypropyl(methyl)amino]ethyl]benzamide |
| SMILES | COCCCN(C)CCNC(=O)c1cc(Cl)c(N)cc1OC |
| InChI | InChI=1S/C15H24ClN3O3/c1-19(6-4-8-21-2)7-5-18-15(20)11-9-12(16)13(17)10-14(11)22-3/h9-10H,4-8,17H2,1-3H3,(H,18,20) |
| InChIKey | HBTPFZDGZXYVOR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|