C20H25Cl2N3O2 — CID 12861899
4-amino-5-chloro-N-[2-[(4-chlorophenyl)methyl-propan-2-ylamino]ethyl]-2-methoxybenzamide (PubChem CID 12861899) has the molecular formula C20H25Cl2N3O2 and a molecular weight of 410.35 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[2-[(4-chlorophenyl)methyl-propan-2-ylamino]ethyl]-2-methoxybenzamide.
| Compound Name | 4-amino-5-chloro-N-[2-[(4-chlorophenyl)methyl-propan-2-ylamino]ethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 12861899 |
| Molecular Formula | C20H25Cl2N3O2 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 4-amino-5-chloro-N-[2-[(4-chlorophenyl)methyl-propan-2-ylamino]ethyl]-2-methoxybenzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCCN(Cc1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C20H25Cl2N3O2/c1-13(2)25(12-14-4-6-15(21)7-5-14)9-8-24-20(26)16-10-17(22)18(23)11-19(16)27-3/h4-7,10-11,13H,8-9,12,23H2,1-3H3,(H,24,26) |
| InChIKey | LZAGACLXEGUEOT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|