C10H13Cl3N2O2 — CID 119384245
N-(2-aminoethyl)-4,5-dichloro-2-methoxybenzamide;hydrochloride (PubChem CID 119384245) has the molecular formula C10H13Cl3N2O2 and a molecular weight of 299.59 g/mol. Its IUPAC name is N-(2-aminoethyl)-4,5-dichloro-2-methoxybenzamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-4,5-dichloro-2-methoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 119384245 |
| Molecular Formula | C10H13Cl3N2O2 |
| Molecular Weight | 299.59 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | N-(2-aminoethyl)-4,5-dichloro-2-methoxybenzamide;hydrochloride |
| SMILES | COc1cc(Cl)c(Cl)cc1C(=O)NCCN.Cl |
| InChI | InChI=1S/C10H12Cl2N2O2.ClH/c1-16-9-5-8(12)7(11)4-6(9)10(15)14-3-2-13;/h4-5H,2-3,13H2,1H3,(H,14,15);1H |
| InChIKey | KDHMMZRMTRJHSG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.59 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |