C11H15FN2O3 — CID 119382400
N-(2-aminoethyl)-2-fluoro-4,5-dimethoxybenzamide (PubChem CID 119382400) has the molecular formula C11H15FN2O3 and a molecular weight of 242.25 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-fluoro-4,5-dimethoxybenzamide.
| Compound Name | N-(2-aminoethyl)-2-fluoro-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 119382400 |
| Molecular Formula | C11H15FN2O3 |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | N-(2-aminoethyl)-2-fluoro-4,5-dimethoxybenzamide |
| SMILES | COc1cc(F)c(C(=O)NCCN)cc1OC |
| InChI | InChI=1S/C11H15FN2O3/c1-16-9-5-7(11(15)14-4-3-13)8(12)6-10(9)17-2/h5-6H,3-4,13H2,1-2H3,(H,14,15) |
| InChIKey | BOHWFONSKDIUPN-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |