C11H15NO5 — CID 67742482
2-hydroxy-N-(2-hydroxyethyl)-4,5-dimethoxybenzamide (PubChem CID 67742482) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is 2-hydroxy-N-(2-hydroxyethyl)-4,5-dimethoxybenzamide.
| Compound Name | 2-hydroxy-N-(2-hydroxyethyl)-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 67742482 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-hydroxy-N-(2-hydroxyethyl)-4,5-dimethoxybenzamide |
| SMILES | COc1cc(O)c(C(=O)NCCO)cc1OC |
| InChI | InChI=1S/C11H15NO5/c1-16-9-5-7(11(15)12-3-4-13)8(14)6-10(9)17-2/h5-6,13-14H,3-4H2,1-2H3,(H,12,15) |
| InChIKey | UFGPYDXBCKBKJB-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |