C15H21ClN3O4- — CID 12883877
2-chloro-4-N-[2-(diethylamino)ethyl]-5-methoxy-1-N-oxidobenzene-1,4-dicarboxamide (PubChem CID 12883877) has the molecular formula C15H21ClN3O4- and a molecular weight of 342.80 g/mol. Its IUPAC name is 2-chloro-4-N-[2-(diethylamino)ethyl]-5-methoxy-1-N-oxidobenzene-1,4-dicarboxamide.
| Compound Name | 2-chloro-4-N-[2-(diethylamino)ethyl]-5-methoxy-1-N-oxidobenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 12883877 |
| Molecular Formula | C15H21ClN3O4- |
| Molecular Weight | 342.80 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-chloro-4-N-[2-(diethylamino)ethyl]-5-methoxy-1-N-oxidobenzene-1,4-dicarboxamide |
| SMILES | CCN(CC)CCNC(=O)c1cc(Cl)c(C(=O)N[O-])cc1OC |
| InChI | InChI=1S/C15H21ClN3O4/c1-4-19(5-2)7-6-17-14(20)11-8-12(16)10(15(21)18-22)9-13(11)23-3/h8-9H,4-7H2,1-3H3,(H2-,17,18,20,21,22)/q-1 |
| InChIKey | SMLQRDZXIVFACB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.80 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|