C17H27ClN4O3 — CID 173373116
[5-amino-4-chloro-2-[2-(diethylamino)ethylcarbamoyl]phenyl] N-methoxypropanimidate (PubChem CID 173373116) has the molecular formula C17H27ClN4O3 and a molecular weight of 370.88 g/mol. Its IUPAC name is [5-amino-4-chloro-2-[2-(diethylamino)ethylcarbamoyl]phenyl] N-methoxypropanimidate.
| Compound Name | [5-amino-4-chloro-2-[2-(diethylamino)ethylcarbamoyl]phenyl] N-methoxypropanimidate |
|---|---|
| PubChem CID | 173373116 |
| Molecular Formula | C17H27ClN4O3 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | [5-amino-4-chloro-2-[2-(diethylamino)ethylcarbamoyl]phenyl] N-methoxypropanimidate |
| SMILES | CCC(=NOC)Oc1cc(N)c(Cl)cc1C(=O)NCCN(CC)CC |
| InChI | InChI=1S/C17H27ClN4O3/c1-5-16(21-24-4)25-15-11-14(19)13(18)10-12(15)17(23)20-8-9-22(6-2)7-3/h10-11H,5-9,19H2,1-4H3,(H,20,23) |
| InChIKey | NYFROVHZZRGRON-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|