C17H29ClN4O6 — CID 67926077
acetic acid;4-amino-2-(2-amino-2-oxoethoxy)-5-chloro-N-[2-(diethylamino)ethyl]benzamide;hydrate (PubChem CID 67926077) has the molecular formula C17H29ClN4O6 and a molecular weight of 420.89 g/mol. Its IUPAC name is acetic acid;4-amino-2-(2-amino-2-oxoethoxy)-5-chloro-N-[2-(diethylamino)ethyl]benzamide;hydrate.
| Compound Name | acetic acid;4-amino-2-(2-amino-2-oxoethoxy)-5-chloro-N-[2-(diethylamino)ethyl]benzamide;hydrate |
|---|---|
| PubChem CID | 67926077 |
| Molecular Formula | C17H29ClN4O6 |
| Molecular Weight | 420.89 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | acetic acid;4-amino-2-(2-amino-2-oxoethoxy)-5-chloro-N-[2-(diethylamino)ethyl]benzamide;hydrate |
| SMILES | CC(=O)O.CCN(CC)CCNC(=O)c1cc(Cl)c(N)cc1OCC(N)=O.O |
| InChI | InChI=1S/C15H23ClN4O3.C2H4O2.H2O/c1-3-20(4-2)6-5-19-15(22)10-7-11(16)12(17)8-13(10)23-9-14(18)21;1-2(3)4;/h7-8H,3-6,9,17H2,1-2H3,(H2,18,21)(H,19,22);1H3,(H,3,4);1H2 |
| InChIKey | FTKUZLFNCOFZHH-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 179.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.89 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|