C17H27ClN4O5 — CID 88513966
acetic acid;4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-(formamidomethoxy)benzamide (PubChem CID 88513966) has the molecular formula C17H27ClN4O5 and a molecular weight of 402.88 g/mol. Its IUPAC name is acetic acid;4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-(formamidomethoxy)benzamide.
| Compound Name | acetic acid;4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-(formamidomethoxy)benzamide |
|---|---|
| PubChem CID | 88513966 |
| Molecular Formula | C17H27ClN4O5 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | acetic acid;4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-(formamidomethoxy)benzamide |
| SMILES | CC(=O)O.CCN(CC)CCNC(=O)c1cc(Cl)c(N)cc1OCNC=O |
| InChI | InChI=1S/C15H23ClN4O3.C2H4O2/c1-3-20(4-2)6-5-19-15(22)11-7-12(16)13(17)8-14(11)23-10-18-9-21;1-2(3)4/h7-9H,3-6,10,17H2,1-2H3,(H,18,21)(H,19,22);1H3,(H,3,4) |
| InChIKey | KTOSJALUTJXBRC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|