C14H24ClN3O6S — CID 175479725
4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-(hydroxymethyl)benzamide;sulfuric acid (PubChem CID 175479725) has the molecular formula C14H24ClN3O6S and a molecular weight of 397.88 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-(hydroxymethyl)benzamide;sulfuric acid.
| Compound Name | 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-(hydroxymethyl)benzamide;sulfuric acid |
|---|---|
| PubChem CID | 175479725 |
| Molecular Formula | C14H24ClN3O6S |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-(hydroxymethyl)benzamide;sulfuric acid |
| SMILES | CCN(CC)CCNC(=O)c1cc(Cl)c(N)cc1CO.O=S(=O)(O)O |
| InChI | InChI=1S/C14H22ClN3O2.H2O4S/c1-3-18(4-2)6-5-17-14(20)11-8-12(15)13(16)7-10(11)9-19;1-5(2,3)4/h7-8,19H,3-6,9,16H2,1-2H3,(H,17,20);(H2,1,2,3,4) |
| InChIKey | HGILSMORZFUMPI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 153.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|