C13H22N4O — CID 21398311
2,5-diamino-N-[2-(diethylamino)ethyl]benzamide (PubChem CID 21398311) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is 2,5-diamino-N-[2-(diethylamino)ethyl]benzamide.
| Compound Name | 2,5-diamino-N-[2-(diethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 21398311 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 2,5-diamino-N-[2-(diethylamino)ethyl]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1cc(N)ccc1N |
| InChI | InChI=1S/C13H22N4O/c1-3-17(4-2)8-7-16-13(18)11-9-10(14)5-6-12(11)15/h5-6,9H,3-4,7-8,14-15H2,1-2H3,(H,16,18) |
| InChIKey | DRSACKLAHLJYFZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|