C14H21ClN2O4 — CID 119672646
4-amino-5-chloro-2-methoxy-N,N-bis(2-methoxyethyl)benzamide (PubChem CID 119672646) has the molecular formula C14H21ClN2O4 and a molecular weight of 316.79 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N,N-bis(2-methoxyethyl)benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N,N-bis(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 119672646 |
| Molecular Formula | C14H21ClN2O4 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N,N-bis(2-methoxyethyl)benzamide |
| SMILES | COCCN(CCOC)C(=O)c1cc(Cl)c(N)cc1OC |
| InChI | InChI=1S/C14H21ClN2O4/c1-19-6-4-17(5-7-20-2)14(18)10-8-11(15)12(16)9-13(10)21-3/h8-9H,4-7,16H2,1-3H3 |
| InChIKey | SLIUCQRDRVIBLS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|