C18H21ClN2O5 — CID 119802021
4-amino-5-chloro-2-methoxy-N-methyl-N-(3,4,5-trimethoxyphenyl)benzamide (PubChem CID 119802021) has the molecular formula C18H21ClN2O5 and a molecular weight of 380.83 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-methyl-N-(3,4,5-trimethoxyphenyl)benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-methyl-N-(3,4,5-trimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 119802021 |
| Molecular Formula | C18H21ClN2O5 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-methyl-N-(3,4,5-trimethoxyphenyl)benzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N(C)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C18H21ClN2O5/c1-21(10-6-15(24-3)17(26-5)16(7-10)25-4)18(22)11-8-12(19)13(20)9-14(11)23-2/h6-9H,20H2,1-5H3 |
| InChIKey | SXTJGCDWBMTYIT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|