C8H7ClNNaO3 — CID 24820370
sodium 4-amino-5-chloro-2-methoxybenzoate (PubChem CID 24820370) has the molecular formula C8H7ClNNaO3 and a molecular weight of 223.59 g/mol. Its IUPAC name is sodium 4-amino-5-chloro-2-methoxybenzoate.
| Compound Name | sodium 4-amino-5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 24820370 |
| Molecular Formula | C8H7ClNNaO3 |
| Molecular Weight | 223.59 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | sodium 4-amino-5-chloro-2-methoxybenzoate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)[O-].[Na+] |
| InChI | InChI=1S/C8H8ClNO3.Na/c1-13-7-3-6(10)5(9)2-4(7)8(11)12;/h2-3H,10H2,1H3,(H,11,12);/q;+1/p-1 |
| InChIKey | KGPXXRPSMZHUTE-UHFFFAOYSA-M |
| XLogP | -2.70 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.59 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|