About propan-2-yloxycarbonyl 4-amino-5-chloro-2-methoxybenzoate
propan-2-yloxycarbonyl 4-amino-5-chloro-2-methoxybenzoate (PubChem CID 102269821) has the molecular formula C12H14ClNO5
and a molecular weight of 287.70 g/mol. Its IUPAC name is propan-2-yloxycarbonyl 4-amino-5-chloro-2-methoxybenzoate.
Molecular Properties
| Compound Name | propan-2-yloxycarbonyl 4-amino-5-chloro-2-methoxybenzoate |
| PubChem CID | 102269821 |
| Molecular Formula | C12H14ClNO5 |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | propan-2-yloxycarbonyl 4-amino-5-chloro-2-methoxybenzoate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)OC(=O)OC(C)C |
| InChI | InChI=1S/C12H14ClNO5/c1-6(2)18-12(16)19-11(15)7-4-8(13)9(14)5-10(7)17-3/h4-6H,14H2,1-3H3 |
| InChIKey | HZZYCZWUABBLGT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yloxycarbonyl 4-amino-5-chloro-2-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yloxycarbonyl 4-amino-5-chloro-2-methoxybenzoate?
The IUPAC name of propan-2-yloxycarbonyl 4-amino-5-chloro-2-methoxybenzoate (CID 102269821) is propan-2-yloxycarbonyl 4-amino-5-chloro-2-methoxybenzoate.
What is the SMILES notation for propan-2-yloxycarbonyl 4-amino-5-chloro-2-methoxybenzoate?
The canonical SMILES for propan-2-yloxycarbonyl 4-amino-5-chloro-2-methoxybenzoate is COc1cc(N)c(Cl)cc1C(=O)OC(=O)OC(C)C.
What is the InChIKey of propan-2-yloxycarbonyl 4-amino-5-chloro-2-methoxybenzoate?
The InChIKey is HZZYCZWUABBLGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClNO5/c1-6(2)18-12(16)19-11(15)7-4-8(13)9(14)5-10(7)17-3/h4-6H,14H2,1-3H3.
What are the key properties of propan-2-yloxycarbonyl 4-amino-5-chloro-2-methoxybenzoate?
propan-2-yloxycarbonyl 4-amino-5-chloro-2-methoxybenzoate has a molecular weight of 287.70 g/mol, XLogP of 2.63, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yloxycarbonyl 4-amino-5-chloro-2-methoxybenzoate is sourced from PubChem (CID 102269821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).