C15H18Cl2N2O3 — CID 119958197
4-amino-5-chloro-2-methoxy-N-methyl-N-[(5-methylfuran-2-yl)methyl]benzamide;hydrochloride (PubChem CID 119958197) has the molecular formula C15H18Cl2N2O3 and a molecular weight of 345.23 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-methyl-N-[(5-methylfuran-2-yl)methyl]benzamide;hydrochloride.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-methyl-N-[(5-methylfuran-2-yl)methyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119958197 |
| Molecular Formula | C15H18Cl2N2O3 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-methyl-N-[(5-methylfuran-2-yl)methyl]benzamide;hydrochloride |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N(C)Cc1ccc(C)o1.Cl |
| InChI | InChI=1S/C15H17ClN2O3.ClH/c1-9-4-5-10(21-9)8-18(2)15(19)11-6-12(16)13(17)7-14(11)20-3;/h4-7H,8,17H2,1-3H3;1H |
| InChIKey | LWKAWAHIUDZNTR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|