C18H22Cl2N2O4 — CID 119689180
4-amino-5-chloro-2-methoxy-N-[2-(4-methoxyphenoxy)ethyl]-N-methylbenzamide;hydrochloride (PubChem CID 119689180) has the molecular formula C18H22Cl2N2O4 and a molecular weight of 401.29 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[2-(4-methoxyphenoxy)ethyl]-N-methylbenzamide;hydrochloride.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[2-(4-methoxyphenoxy)ethyl]-N-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119689180 |
| Molecular Formula | C18H22Cl2N2O4 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[2-(4-methoxyphenoxy)ethyl]-N-methylbenzamide;hydrochloride |
| SMILES | COc1ccc(OCCN(C)C(=O)c2cc(Cl)c(N)cc2OC)cc1.Cl |
| InChI | InChI=1S/C18H21ClN2O4.ClH/c1-21(8-9-25-13-6-4-12(23-2)5-7-13)18(22)14-10-15(19)16(20)11-17(14)24-3;/h4-7,10-11H,8-9,20H2,1-3H3;1H |
| InChIKey | XPYYYMZHASTKHD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|