C18H20BrNO4 — CID 112793987
N-[2-(4-bromophenoxy)ethyl]-2,4-dimethoxy-N-methylbenzamide (PubChem CID 112793987) has the molecular formula C18H20BrNO4 and a molecular weight of 394.27 g/mol. Its IUPAC name is N-[2-(4-bromophenoxy)ethyl]-2,4-dimethoxy-N-methylbenzamide.
| Compound Name | N-[2-(4-bromophenoxy)ethyl]-2,4-dimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 112793987 |
| Molecular Formula | C18H20BrNO4 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-[2-(4-bromophenoxy)ethyl]-2,4-dimethoxy-N-methylbenzamide |
| SMILES | COc1ccc(C(=O)N(C)CCOc2ccc(Br)cc2)c(OC)c1 |
| InChI | InChI=1S/C18H20BrNO4/c1-20(10-11-24-14-6-4-13(19)5-7-14)18(21)16-9-8-15(22-2)12-17(16)23-3/h4-9,12H,10-11H2,1-3H3 |
| InChIKey | HRPRSQABWDWSEP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |