C22H30ClN5O4 — CID 141247863
2-[4-[[2-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]morpholin-4-yl]methyl]piperidin-1-yl]acetyl cyanide (PubChem CID 141247863) has the molecular formula C22H30ClN5O4 and a molecular weight of 463.97 g/mol. Its IUPAC name is 2-[4-[[2-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]morpholin-4-yl]methyl]piperidin-1-yl]acetyl cyanide.
| Compound Name | 2-[4-[[2-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]morpholin-4-yl]methyl]piperidin-1-yl]acetyl cyanide |
|---|---|
| PubChem CID | 141247863 |
| Molecular Formula | C22H30ClN5O4 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 2-[4-[[2-[[(4-amino-5-chloro-2-methoxybenzoyl)amino]methyl]morpholin-4-yl]methyl]piperidin-1-yl]acetyl cyanide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC1CN(CC2CCN(CC(=O)C#N)CC2)CCO1 |
| InChI | InChI=1S/C22H30ClN5O4/c1-31-21-9-20(25)19(23)8-18(21)22(30)26-11-17-14-28(6-7-32-17)12-15-2-4-27(5-3-15)13-16(29)10-24/h8-9,15,17H,2-7,11-14,25H2,1H3,(H,26,30) |
| InChIKey | XRQKHOWOUSUKRX-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 120.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|