C23H37ClN4O5 — CID 143850814
4-amino-5-chloro-2-ethoxy-N-[[4-[(1-methylpiperidin-4-yl)methyl]morpholin-2-yl]methyl]benzamide;2-hydroxyacetaldehyde (PubChem CID 143850814) has the molecular formula C23H37ClN4O5 and a molecular weight of 485.03 g/mol. Its IUPAC name is 4-amino-5-chloro-2-ethoxy-N-[[4-[(1-methylpiperidin-4-yl)methyl]morpholin-2-yl]methyl]benzamide;2-hydroxyacetaldehyde.
| Compound Name | 4-amino-5-chloro-2-ethoxy-N-[[4-[(1-methylpiperidin-4-yl)methyl]morpholin-2-yl]methyl]benzamide;2-hydroxyacetaldehyde |
|---|---|
| PubChem CID | 143850814 |
| Molecular Formula | C23H37ClN4O5 |
| Molecular Weight | 485.03 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 4-amino-5-chloro-2-ethoxy-N-[[4-[(1-methylpiperidin-4-yl)methyl]morpholin-2-yl]methyl]benzamide;2-hydroxyacetaldehyde |
| SMILES | CCOc1cc(N)c(Cl)cc1C(=O)NCC1CN(CC2CCN(C)CC2)CCO1.O=CCO |
| InChI | InChI=1S/C21H33ClN4O3.C2H4O2/c1-3-28-20-11-19(23)18(22)10-17(20)21(27)24-12-16-14-26(8-9-29-16)13-15-4-6-25(2)7-5-15;3-1-2-4/h10-11,15-16H,3-9,12-14,23H2,1-2H3,(H,24,27);1,4H,2H2 |
| InChIKey | ZESTVDNLSDADCV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.03 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|