C21H24ClF2N3O3 — CID 14877428
4-amino-5-chloro-N-[[4-[(2,4-difluorophenyl)methyl]morpholin-2-yl]methyl]-2-ethoxybenzamide (PubChem CID 14877428) has the molecular formula C21H24ClF2N3O3 and a molecular weight of 439.89 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[[4-[(2,4-difluorophenyl)methyl]morpholin-2-yl]methyl]-2-ethoxybenzamide.
| Compound Name | 4-amino-5-chloro-N-[[4-[(2,4-difluorophenyl)methyl]morpholin-2-yl]methyl]-2-ethoxybenzamide |
|---|---|
| PubChem CID | 14877428 |
| Molecular Formula | C21H24ClF2N3O3 |
| Molecular Weight | 439.89 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 4-amino-5-chloro-N-[[4-[(2,4-difluorophenyl)methyl]morpholin-2-yl]methyl]-2-ethoxybenzamide |
| SMILES | CCOc1cc(N)c(Cl)cc1C(=O)NCC1CN(Cc2ccc(F)cc2F)CCO1 |
| InChI | InChI=1S/C21H24ClF2N3O3/c1-2-29-20-9-19(25)17(22)8-16(20)21(28)26-10-15-12-27(5-6-30-15)11-13-3-4-14(23)7-18(13)24/h3-4,7-9,15H,2,5-6,10-12,25H2,1H3,(H,26,28) |
| InChIKey | MMKGBABWESAOLC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.89 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|