C24H29ClFN3O3 — CID 14881964
4-amino-5-chloro-N-[[4-[(4-fluorophenyl)methyl]morpholin-2-yl]methyl]-2-(3-methylbut-2-enoxy)benzamide (PubChem CID 14881964) has the molecular formula C24H29ClFN3O3 and a molecular weight of 461.97 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[[4-[(4-fluorophenyl)methyl]morpholin-2-yl]methyl]-2-(3-methylbut-2-enoxy)benzamide.
| Compound Name | 4-amino-5-chloro-N-[[4-[(4-fluorophenyl)methyl]morpholin-2-yl]methyl]-2-(3-methylbut-2-enoxy)benzamide |
|---|---|
| PubChem CID | 14881964 |
| Molecular Formula | C24H29ClFN3O3 |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 4-amino-5-chloro-N-[[4-[(4-fluorophenyl)methyl]morpholin-2-yl]methyl]-2-(3-methylbut-2-enoxy)benzamide |
| SMILES | CC(C)=CCOc1cc(N)c(Cl)cc1C(=O)NCC1CN(Cc2ccc(F)cc2)CCO1 |
| InChI | InChI=1S/C24H29ClFN3O3/c1-16(2)7-9-32-23-12-22(27)21(25)11-20(23)24(30)28-13-19-15-29(8-10-31-19)14-17-3-5-18(26)6-4-17/h3-7,11-12,19H,8-10,13-15,27H2,1-2H3,(H,28,30) |
| InChIKey | WUSNEJXCOKLTNK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|