C19H21FN2O4 — CID 126678400
N-[[4-[(4-fluorophenyl)methyl]morpholin-2-yl]methyl]-2,5-dihydroxybenzamide (PubChem CID 126678400) has the molecular formula C19H21FN2O4 and a molecular weight of 360.39 g/mol. Its IUPAC name is N-[[4-[(4-fluorophenyl)methyl]morpholin-2-yl]methyl]-2,5-dihydroxybenzamide.
| Compound Name | N-[[4-[(4-fluorophenyl)methyl]morpholin-2-yl]methyl]-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 126678400 |
| Molecular Formula | C19H21FN2O4 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-[[4-[(4-fluorophenyl)methyl]morpholin-2-yl]methyl]-2,5-dihydroxybenzamide |
| SMILES | O=C(NCC1CN(Cc2ccc(F)cc2)CCO1)c1cc(O)ccc1O |
| InChI | InChI=1S/C19H21FN2O4/c20-14-3-1-13(2-4-14)11-22-7-8-26-16(12-22)10-21-19(25)17-9-15(23)5-6-18(17)24/h1-6,9,16,23-24H,7-8,10-12H2,(H,21,25) |
| InChIKey | KLNTXCRCMVAUIC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|