C26H28FN3O4S — CID 43021327
N-[(4-benzylmorpholin-2-yl)methyl]-5-[(4-fluorophenyl)sulfamoyl]-2-methylbenzamide (PubChem CID 43021327) has the molecular formula C26H28FN3O4S and a molecular weight of 497.59 g/mol. Its IUPAC name is N-[(4-benzylmorpholin-2-yl)methyl]-5-[(4-fluorophenyl)sulfamoyl]-2-methylbenzamide.
| Compound Name | N-[(4-benzylmorpholin-2-yl)methyl]-5-[(4-fluorophenyl)sulfamoyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 43021327 |
| Molecular Formula | C26H28FN3O4S |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | N-[(4-benzylmorpholin-2-yl)methyl]-5-[(4-fluorophenyl)sulfamoyl]-2-methylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(F)cc2)cc1C(=O)NCC1CN(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C26H28FN3O4S/c1-19-7-12-24(35(32,33)29-22-10-8-21(27)9-11-22)15-25(19)26(31)28-16-23-18-30(13-14-34-23)17-20-5-3-2-4-6-20/h2-12,15,23,29H,13-14,16-18H2,1H3,(H,28,31) |
| InChIKey | WMYCWHJGWLOBKL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |