C27H41ClN4O5 — CID 89066123
1-azabicyclo[5.2.0]nonan-3-yl 5-[2-[[(4-amino-5-chloro-2-ethoxybenzoyl)amino]methyl]morpholin-4-yl]pentanoate (PubChem CID 89066123) has the molecular formula C27H41ClN4O5 and a molecular weight of 537.10 g/mol. Its IUPAC name is 1-azabicyclo[5.2.0]nonan-3-yl 5-[2-[[(4-amino-5-chloro-2-ethoxybenzoyl)amino]methyl]morpholin-4-yl]pentanoate.
| Compound Name | 1-azabicyclo[5.2.0]nonan-3-yl 5-[2-[[(4-amino-5-chloro-2-ethoxybenzoyl)amino]methyl]morpholin-4-yl]pentanoate |
|---|---|
| PubChem CID | 89066123 |
| Molecular Formula | C27H41ClN4O5 |
| Molecular Weight | 537.10 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | 1-azabicyclo[5.2.0]nonan-3-yl 5-[2-[[(4-amino-5-chloro-2-ethoxybenzoyl)amino]methyl]morpholin-4-yl]pentanoate |
| SMILES | CCOc1cc(N)c(Cl)cc1C(=O)NCC1CN(CCCCC(=O)OC2CCCC3CCN3C2)CCO1 |
| InChI | InChI=1S/C27H41ClN4O5/c1-2-35-25-15-24(29)23(28)14-22(25)27(34)30-16-21-17-31(12-13-36-21)10-4-3-8-26(33)37-20-7-5-6-19-9-11-32(19)18-20/h14-15,19-21H,2-13,16-18,29H2,1H3,(H,30,34) |
| InChIKey | PZKBUJNNWDDUSP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.10 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|