C26H39IN4O5 — CID 89042160
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 6-[(2S)-2-[[(4-amino-5-iodo-2-methoxybenzoyl)amino]methyl]morpholin-4-yl]hexanoate (PubChem CID 89042160) has the molecular formula C26H39IN4O5 and a molecular weight of 614.53 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 6-[(2S)-2-[[(4-amino-5-iodo-2-methoxybenzoyl)amino]methyl]morpholin-4-yl]hexanoate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 6-[(2S)-2-[[(4-amino-5-iodo-2-methoxybenzoyl)amino]methyl]morpholin-4-yl]hexanoate |
|---|---|
| PubChem CID | 89042160 |
| Molecular Formula | C26H39IN4O5 |
| Molecular Weight | 614.53 g/mol |
| Exact Mass | 614.20 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 6-[(2S)-2-[[(4-amino-5-iodo-2-methoxybenzoyl)amino]methyl]morpholin-4-yl]hexanoate |
| SMILES | COc1cc(N)c(I)cc1C(=O)NC[C@H]1CN(CCCCCC(=O)O[C@H]2CN3CCC2CC3)CCO1 |
| InChI | InChI=1S/C26H39IN4O5/c1-34-23-14-22(28)21(27)13-20(23)26(33)29-15-19-16-30(11-12-35-19)8-4-2-3-5-25(32)36-24-17-31-9-6-18(24)7-10-31/h13-14,18-19,24H,2-12,15-17,28H2,1H3,(H,29,33)/t19-,24-/m0/s1 |
| InChIKey | AXHKZTQDEFOTOX-CYFREDJKSA-N |
| XLogP | 2.51 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.53 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|