C26H39ClN4O5 — CID 143080856
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 6-[(3S,4R)-4-[(4-amino-2-chloro-6-methoxybenzoyl)amino]-3-hydroxypiperidin-1-yl]hexanoate (PubChem CID 143080856) has the molecular formula C26H39ClN4O5 and a molecular weight of 523.07 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 6-[(3S,4R)-4-[(4-amino-2-chloro-6-methoxybenzoyl)amino]-3-hydroxypiperidin-1-yl]hexanoate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 6-[(3S,4R)-4-[(4-amino-2-chloro-6-methoxybenzoyl)amino]-3-hydroxypiperidin-1-yl]hexanoate |
|---|---|
| PubChem CID | 143080856 |
| Molecular Formula | C26H39ClN4O5 |
| Molecular Weight | 523.07 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 6-[(3S,4R)-4-[(4-amino-2-chloro-6-methoxybenzoyl)amino]-3-hydroxypiperidin-1-yl]hexanoate |
| SMILES | COc1cc(N)cc(Cl)c1C(=O)N[C@@H]1CCN(CCCCCC(=O)O[C@H]2CN3CCC2CC3)C[C@@H]1O |
| InChI | InChI=1S/C26H39ClN4O5/c1-35-22-14-18(28)13-19(27)25(22)26(34)29-20-8-12-30(15-21(20)32)9-4-2-3-5-24(33)36-23-16-31-10-6-17(23)7-11-31/h13-14,17,20-21,23,32H,2-12,15-16,28H2,1H3,(H,29,34)/t20-,21+,23+/m1/s1 |
| InChIKey | KUVZNVDVQVSWCF-GIWBLDEGSA-N |
| XLogP | 2.29 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.07 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|