C27H44N4O5 — CID 143775626
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 5-[(2S)-2-[[[(4-amino-2-ethoxy-5-methylphenyl)-hydroxymethyl]amino]methyl]morpholin-4-yl]pentanoate (PubChem CID 143775626) has the molecular formula C27H44N4O5 and a molecular weight of 504.67 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 5-[(2S)-2-[[[(4-amino-2-ethoxy-5-methylphenyl)-hydroxymethyl]amino]methyl]morpholin-4-yl]pentanoate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 5-[(2S)-2-[[[(4-amino-2-ethoxy-5-methylphenyl)-hydroxymethyl]amino]methyl]morpholin-4-yl]pentanoate |
|---|---|
| PubChem CID | 143775626 |
| Molecular Formula | C27H44N4O5 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.33 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 5-[(2S)-2-[[[(4-amino-2-ethoxy-5-methylphenyl)-hydroxymethyl]amino]methyl]morpholin-4-yl]pentanoate |
| SMILES | CCOc1cc(N)c(C)cc1C(O)NC[C@H]1CN(CCCCC(=O)O[C@H]2CN3CCC2CC3)CCO1 |
| InChI | InChI=1S/C27H44N4O5/c1-3-34-24-15-23(28)19(2)14-22(24)27(33)29-16-21-17-30(12-13-35-21)9-5-4-6-26(32)36-25-18-31-10-7-20(25)8-11-31/h14-15,20-21,25,27,29,33H,3-13,16-18,28H2,1-2H3/t21-,25-,27?/m0/s1 |
| InChIKey | OXYXFRKLTMDVSL-FLNRHSFLSA-N |
| XLogP | 2.06 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|