C28H43ClN4O5 — CID 89066105
[(3R)-1-azabicyclo[5.2.0]nonan-3-yl] 6-[(2R)-2-[[(4-amino-5-chloro-2-ethoxybenzoyl)amino]methyl]morpholin-4-yl]hexanoate (PubChem CID 89066105) has the molecular formula C28H43ClN4O5 and a molecular weight of 551.13 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[5.2.0]nonan-3-yl] 6-[(2R)-2-[[(4-amino-5-chloro-2-ethoxybenzoyl)amino]methyl]morpholin-4-yl]hexanoate.
| Compound Name | [(3R)-1-azabicyclo[5.2.0]nonan-3-yl] 6-[(2R)-2-[[(4-amino-5-chloro-2-ethoxybenzoyl)amino]methyl]morpholin-4-yl]hexanoate |
|---|---|
| PubChem CID | 89066105 |
| Molecular Formula | C28H43ClN4O5 |
| Molecular Weight | 551.13 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | [(3R)-1-azabicyclo[5.2.0]nonan-3-yl] 6-[(2R)-2-[[(4-amino-5-chloro-2-ethoxybenzoyl)amino]methyl]morpholin-4-yl]hexanoate |
| SMILES | CCOc1cc(N)c(Cl)cc1C(=O)NC[C@@H]1CN(CCCCCC(=O)O[C@@H]2CCCC3CCN3C2)CCO1 |
| InChI | InChI=1S/C28H43ClN4O5/c1-2-36-26-16-25(30)24(29)15-23(26)28(35)31-17-22-18-32(13-14-37-22)11-5-3-4-9-27(34)38-21-8-6-7-20-10-12-33(20)19-21/h15-16,20-22H,2-14,17-19,30H2,1H3,(H,31,35)/t20?,21-,22-/m1/s1 |
| InChIKey | KNJUYTAMQSWHSI-HRUVVLKGSA-N |
| XLogP | 3.48 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.13 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|