C14H19BIN3O3 — CID 88966471
CID 88966471 (PubChem CID 88966471) has the molecular formula C14H19BIN3O3 and a molecular weight of 415.04 g/mol.
| Compound Name | CID 88966471 |
|---|---|
| PubChem CID | 88966471 |
| Molecular Formula | C14H19BIN3O3 |
| Molecular Weight | 415.04 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | — |
| SMILES | [B]N1CCCOC(CNC(=O)c2cc(I)c(N)cc2OC)C1 |
| InChI | InChI=1S/C14H19BIN3O3/c1-21-13-6-12(17)11(16)5-10(13)14(20)18-7-9-8-19(15)3-2-4-22-9/h5-6,9H,2-4,7-8,17H2,1H3,(H,18,20) |
| InChIKey | CKXGMMVSNPNWLX-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.04 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|