C21H28BClN4O4 — CID 59510499
CID 59510499 (PubChem CID 59510499) has the molecular formula C21H28BClN4O4 and a molecular weight of 446.74 g/mol.
| Compound Name | CID 59510499 |
|---|---|
| PubChem CID | 59510499 |
| Molecular Formula | C21H28BClN4O4 |
| Molecular Weight | 446.74 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N1CCC(CN2CCO[C@@H](CNC(=O)c3cc(Cl)c(N)c4c3OCC4)C2)CC1 |
| InChI | InChI=1S/C21H28BClN4O4/c22-21(29)27-4-1-13(2-5-27)11-26-6-8-30-14(12-26)10-25-20(28)16-9-17(23)18(24)15-3-7-31-19(15)16/h9,13-14H,1-8,10-12,24H2,(H,25,28)/t14-/m0/s1 |
| InChIKey | LLCYSXCROIVQSI-AWEZNQCLSA-N |
| XLogP | 1.29 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.74 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|