C20H30ClN3O3 — CID 18007866
5-amino-N-[(1-butyl-3-hydroxypiperidin-4-yl)methyl]-6-chloro-3,4-dihydro-2H-chromene-8-carboxamide (PubChem CID 18007866) has the molecular formula C20H30ClN3O3 and a molecular weight of 395.93 g/mol. Its IUPAC name is 5-amino-N-[(1-butyl-3-hydroxypiperidin-4-yl)methyl]-6-chloro-3,4-dihydro-2H-chromene-8-carboxamide.
| Compound Name | 5-amino-N-[(1-butyl-3-hydroxypiperidin-4-yl)methyl]-6-chloro-3,4-dihydro-2H-chromene-8-carboxamide |
|---|---|
| PubChem CID | 18007866 |
| Molecular Formula | C20H30ClN3O3 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 5-amino-N-[(1-butyl-3-hydroxypiperidin-4-yl)methyl]-6-chloro-3,4-dihydro-2H-chromene-8-carboxamide |
| SMILES | CCCCN1CCC(CNC(=O)c2cc(Cl)c(N)c3c2OCCC3)C(O)C1 |
| InChI | InChI=1S/C20H30ClN3O3/c1-2-3-7-24-8-6-13(17(25)12-24)11-23-20(26)15-10-16(21)18(22)14-5-4-9-27-19(14)15/h10,13,17,25H,2-9,11-12,22H2,1H3,(H,23,26) |
| InChIKey | CHOHOJTZIFTNPA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|