C20H30ClN3O4 — CID 70303119
4-amino-5-chloro-N-[[1-(3,3-dimethoxypropyl)piperidin-4-yl]methyl]-2,3-dihydro-1-benzofuran-7-carboxamide (PubChem CID 70303119) has the molecular formula C20H30ClN3O4 and a molecular weight of 411.93 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[[1-(3,3-dimethoxypropyl)piperidin-4-yl]methyl]-2,3-dihydro-1-benzofuran-7-carboxamide.
| Compound Name | 4-amino-5-chloro-N-[[1-(3,3-dimethoxypropyl)piperidin-4-yl]methyl]-2,3-dihydro-1-benzofuran-7-carboxamide |
|---|---|
| PubChem CID | 70303119 |
| Molecular Formula | C20H30ClN3O4 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 4-amino-5-chloro-N-[[1-(3,3-dimethoxypropyl)piperidin-4-yl]methyl]-2,3-dihydro-1-benzofuran-7-carboxamide |
| SMILES | COC(CCN1CCC(CNC(=O)c2cc(Cl)c(N)c3c2OCC3)CC1)OC |
| InChI | InChI=1S/C20H30ClN3O4/c1-26-17(27-2)5-9-24-7-3-13(4-8-24)12-23-20(25)15-11-16(21)18(22)14-6-10-28-19(14)15/h11,13,17H,3-10,12,22H2,1-2H3,(H,23,25) |
| InChIKey | BIJPFGFQCQGLQH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|