C19H29ClN4O3 — CID 54151467
4-amino-N-[(3S,4R)-1-(4-aminobutyl)-3-methoxypiperidin-4-yl]-5-chloro-2,3-dihydro-1-benzofuran-7-carboxamide (PubChem CID 54151467) has the molecular formula C19H29ClN4O3 and a molecular weight of 396.92 g/mol. Its IUPAC name is 4-amino-N-[(3S,4R)-1-(4-aminobutyl)-3-methoxypiperidin-4-yl]-5-chloro-2,3-dihydro-1-benzofuran-7-carboxamide.
| Compound Name | 4-amino-N-[(3S,4R)-1-(4-aminobutyl)-3-methoxypiperidin-4-yl]-5-chloro-2,3-dihydro-1-benzofuran-7-carboxamide |
|---|---|
| PubChem CID | 54151467 |
| Molecular Formula | C19H29ClN4O3 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 4-amino-N-[(3S,4R)-1-(4-aminobutyl)-3-methoxypiperidin-4-yl]-5-chloro-2,3-dihydro-1-benzofuran-7-carboxamide |
| SMILES | CO[C@H]1CN(CCCCN)CC[C@H]1NC(=O)c1cc(Cl)c(N)c2c1OCC2 |
| InChI | InChI=1S/C19H29ClN4O3/c1-26-16-11-24(7-3-2-6-21)8-4-15(16)23-19(25)13-10-14(20)17(22)12-5-9-27-18(12)13/h10,15-16H,2-9,11,21-22H2,1H3,(H,23,25)/t15-,16+/m1/s1 |
| InChIKey | OIAOIHIWQZDYER-CVEARBPZSA-N |
| XLogP | 1.42 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|